C20H28F2N6O2 — CID 123560330
2,2-difluoropropyl 2-[[[5-cyano-4-[(4-hydroxy-4-methylcyclohexyl)amino]pyrimidin-2-yl]amino]methyl]-N-methylprop-2-enimidate (PubChem CID 123560330) has the molecular formula C20H28F2N6O2 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2,2-difluoropropyl 2-[[[5-cyano-4-[(4-hydroxy-4-methylcyclohexyl)amino]pyrimidin-2-yl]amino]methyl]-N-methylprop-2-enimidate.
| Compound Name | 2,2-difluoropropyl 2-[[[5-cyano-4-[(4-hydroxy-4-methylcyclohexyl)amino]pyrimidin-2-yl]amino]methyl]-N-methylprop-2-enimidate |
|---|---|
| PubChem CID | 123560330 |
| Molecular Formula | C20H28F2N6O2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2,2-difluoropropyl 2-[[[5-cyano-4-[(4-hydroxy-4-methylcyclohexyl)amino]pyrimidin-2-yl]amino]methyl]-N-methylprop-2-enimidate |
| SMILES | C=C(CNc1ncc(C#N)c(NC2CCC(C)(O)CC2)n1)/C(=N/C)OCC(C)(F)F |
| InChI | InChI=1S/C20H28F2N6O2/c1-13(17(24-4)30-12-20(3,21)22)10-25-18-26-11-14(9-23)16(28-18)27-15-5-7-19(2,29)8-6-15/h11,15,29H,1,5-8,10,12H2,2-4H3,(H2,25,26,27,28)/b24-17- |
| InChIKey | UZIBODPWECNDJC-ULJHMMPZSA-N |
| XLogP | 3.12 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|