C19H23ClFNO — CID 123560963
4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-ethylpentan-1-ol (PubChem CID 123560963) has the molecular formula C19H23ClFNO and a molecular weight of 335.85 g/mol. Its IUPAC name is 4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-ethylpentan-1-ol.
| Compound Name | 4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-ethylpentan-1-ol |
|---|---|
| PubChem CID | 123560963 |
| Molecular Formula | C19H23ClFNO |
| Molecular Weight | 335.85 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-ethylpentan-1-ol |
| SMILES | CCC(CO)CC(N)Cc1ccc(-c2cc(Cl)ccc2F)cc1 |
| InChI | InChI=1S/C19H23ClFNO/c1-2-13(12-23)9-17(22)10-14-3-5-15(6-4-14)18-11-16(20)7-8-19(18)21/h3-8,11,13,17,23H,2,9-10,12,22H2,1H3 |
| InChIKey | JSOOISBIFITWRJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |