C16H22N6O3 — CID 123561821
[2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-formylpyrrolidin-3-yl] 2-amino-3-methylbutanoate (PubChem CID 123561821) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is [2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-formylpyrrolidin-3-yl] 2-amino-3-methylbutanoate.
| Compound Name | [2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-formylpyrrolidin-3-yl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 123561821 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-formylpyrrolidin-3-yl] 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)OC1CC(C=O)NC1c1c[nH]c2c(N)ncnc12 |
| InChI | InChI=1S/C16H22N6O3/c1-7(2)11(17)16(24)25-10-3-8(5-23)22-12(10)9-4-19-14-13(9)20-6-21-15(14)18/h4-8,10-12,19,22H,3,17H2,1-2H3,(H2,18,20,21) |
| InChIKey | ZKGIJHJZTFUANJ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|