C18H28O8 — CID 123561847
2-[2-hydroxy-4-(3,4,5-trimethoxyphenyl)butyl]oxane-3,4,5-triol (PubChem CID 123561847) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is 2-[2-hydroxy-4-(3,4,5-trimethoxyphenyl)butyl]oxane-3,4,5-triol.
| Compound Name | 2-[2-hydroxy-4-(3,4,5-trimethoxyphenyl)butyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123561847 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[2-hydroxy-4-(3,4,5-trimethoxyphenyl)butyl]oxane-3,4,5-triol |
| SMILES | COc1cc(CCC(O)CC2OCC(O)C(O)C2O)cc(OC)c1OC |
| InChI | InChI=1S/C18H28O8/c1-23-14-6-10(7-15(24-2)18(14)25-3)4-5-11(19)8-13-17(22)16(21)12(20)9-26-13/h6-7,11-13,16-17,19-22H,4-5,8-9H2,1-3H3 |
| InChIKey | MBTGLLJVXMWRNZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |