C12H21N — CID 123562970
N-ethyl-N,2-dimethylocta-2,4,6-trien-1-amine (PubChem CID 123562970) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N-ethyl-N,2-dimethylocta-2,4,6-trien-1-amine.
| Compound Name | N-ethyl-N,2-dimethylocta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 123562970 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-ethyl-N,2-dimethylocta-2,4,6-trien-1-amine |
| SMILES | CC=CC=CC=C(C)CN(C)CC |
| InChI | InChI=1S/C12H21N/c1-5-7-8-9-10-12(3)11-13(4)6-2/h5,7-10H,6,11H2,1-4H3 |
| InChIKey | QHEUKGFUQBGOOT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|