C23H21F2N4O+ — CID 123563518
N-cyclobutyl-N-[3-[(3,4-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 123563518) has the molecular formula C23H21F2N4O+ and a molecular weight of 407.44 g/mol. Its IUPAC name is N-cyclobutyl-N-[3-[(3,4-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | N-cyclobutyl-N-[3-[(3,4-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 123563518 |
| Molecular Formula | C23H21F2N4O+ |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-cyclobutyl-N-[3-[(3,4-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | Fc1ccc(COc2cccc(N(C3CCC3)[N+]34C=CN=CC3=CN=C4)c2)cc1F |
| InChI | InChI=1S/C23H21F2N4O/c24-22-8-7-17(11-23(22)25)15-30-21-6-2-5-19(12-21)28(18-3-1-4-18)29-10-9-26-13-20(29)14-27-16-29/h2,5-14,16,18H,1,3-4,15H2/q+1 |
| InChIKey | KACLJXLJKRZPDQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|