About 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide
8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide (PubChem CID 123563686) has the molecular formula C18H34BrNO
and a molecular weight of 360.38 g/mol. Its IUPAC name is 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide.
Molecular Properties
| Compound Name | 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide |
| PubChem CID | 123563686 |
| Molecular Formula | C18H34BrNO |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide |
| SMILES | CCC1(NC(=O)CCCCCCCBr)CC(C)CC(C)C1 |
| InChI | InChI=1S/C18H34BrNO/c1-4-18(13-15(2)12-16(3)14-18)20-17(21)10-8-6-5-7-9-11-19/h15-16H,4-14H2,1-3H3,(H,20,21) |
| InChIKey | JNZIZNUVCKLXCQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide?
The IUPAC name of 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide (CID 123563686) is 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide.
What is the SMILES notation for 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide?
The canonical SMILES for 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide is CCC1(NC(=O)CCCCCCCBr)CC(C)CC(C)C1.
What is the InChIKey of 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide?
The InChIKey is JNZIZNUVCKLXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34BrNO/c1-4-18(13-15(2)12-16(3)14-18)20-17(21)10-8-6-5-7-9-11-19/h15-16H,4-14H2,1-3H3,(H,20,21).
What are the key properties of 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide?
8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide has a molecular weight of 360.38 g/mol, XLogP of 5.44, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-N-(1-ethyl-3,5-dimethylcyclohexyl)octanamide is sourced from PubChem (CID 123563686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).