About [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate
[4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate (PubChem CID 123563768) has the molecular formula C12H25N3O4S
and a molecular weight of 307.42 g/mol. Its IUPAC name is [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate.
Molecular Properties
| Compound Name | [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate |
| PubChem CID | 123563768 |
| Molecular Formula | C12H25N3O4S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SC1CC(O)C(O)C(CNCCCO)O1 |
| InChI | InChI=1S/C12H25N3O4S/c1-13-12(14-2)20-10-6-8(17)11(18)9(19-10)7-15-4-3-5-16/h8-11,15-18H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | QNDFQFBDESWYGB-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate?
The IUPAC name of [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate (CID 123563768) is [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate.
What is the SMILES notation for [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate?
The canonical SMILES for [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate is C/N=C(\NC)SC1CC(O)C(O)C(CNCCCO)O1.
What is the InChIKey of [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate?
The InChIKey is QNDFQFBDESWYGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O4S/c1-13-12(14-2)20-10-6-8(17)11(18)9(19-10)7-15-4-3-5-16/h8-11,15-18H,3-7H2,1-2H3,(H,13,14).
What are the key properties of [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate?
[4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate has a molecular weight of 307.42 g/mol, XLogP of -1.27, 6 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-dihydroxy-6-[(3-hydroxypropylamino)methyl]oxan-2-yl] N,N'-dimethylcarbamimidothioate is sourced from PubChem (CID 123563768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).