C11H17NO3S — CID 123564256
1,1-dioxo-3H-1,3-benzothiazol-2-one;ethane (PubChem CID 123564256) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1,1-dioxo-3H-1,3-benzothiazol-2-one;ethane.
| Compound Name | 1,1-dioxo-3H-1,3-benzothiazol-2-one;ethane |
|---|---|
| PubChem CID | 123564256 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1,1-dioxo-3H-1,3-benzothiazol-2-one;ethane |
| SMILES | CC.CC.O=C1Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C7H5NO3S.2C2H6/c9-7-8-5-3-1-2-4-6(5)12(7,10)11;2*1-2/h1-4H,(H,8,9);2*1-2H3 |
| InChIKey | UYGUYTSRXPWUHT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|