C8H5NO3 — CID 123564318
4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one (PubChem CID 123564318) has the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. Its IUPAC name is 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one.
| Compound Name | 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 123564318 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one |
| SMILES | O=C=C1C=CC=C2OC(=O)NC12 |
| InChI | InChI=1S/C8H5NO3/c10-4-5-2-1-3-6-7(5)9-8(11)12-6/h1-3,7H,(H,9,11) |
| InChIKey | NLYKHTXPRKHWTM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|