About 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one
4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one (PubChem CID 123564318) has the molecular formula C8H5NO3
and a molecular weight of 163.13 g/mol. Its IUPAC name is 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one |
| PubChem CID | 123564318 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one |
| SMILES | O=C=C1C=CC=C2OC(=O)NC12 |
| InChI | InChI=1S/C8H5NO3/c10-4-5-2-1-3-6-7(5)9-8(11)12-6/h1-3,7H,(H,9,11) |
| InChIKey | NLYKHTXPRKHWTM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one?
The IUPAC name of 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one (CID 123564318) is 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one.
What is the SMILES notation for 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one?
The canonical SMILES for 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one is O=C=C1C=CC=C2OC(=O)NC12.
What is the InChIKey of 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one?
The InChIKey is NLYKHTXPRKHWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3/c10-4-5-2-1-3-6-7(5)9-8(11)12-6/h1-3,7H,(H,9,11).
What are the key properties of 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one?
4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one has a molecular weight of 163.13 g/mol, XLogP of 0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxomethylidene)-3,3a-dihydro-1,3-benzoxazol-2-one is sourced from PubChem (CID 123564318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).