C28H44FNO — CID 123564427
2-butoxy-N-(1-cyclopent-3-en-1-ylethyl)-4-(3-ethyl-5-fluorocyclohex-2-en-1-yl)-6-propan-2-ylcyclohexa-2,4-dien-1-amine (PubChem CID 123564427) has the molecular formula C28H44FNO and a molecular weight of 429.66 g/mol. Its IUPAC name is 2-butoxy-N-(1-cyclopent-3-en-1-ylethyl)-4-(3-ethyl-5-fluorocyclohex-2-en-1-yl)-6-propan-2-ylcyclohexa-2,4-dien-1-amine.
| Compound Name | 2-butoxy-N-(1-cyclopent-3-en-1-ylethyl)-4-(3-ethyl-5-fluorocyclohex-2-en-1-yl)-6-propan-2-ylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123564427 |
| Molecular Formula | C28H44FNO |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 2-butoxy-N-(1-cyclopent-3-en-1-ylethyl)-4-(3-ethyl-5-fluorocyclohex-2-en-1-yl)-6-propan-2-ylcyclohexa-2,4-dien-1-amine |
| SMILES | CCCCOC1=CC(C2C=C(CC)CC(F)C2)=CC(C(C)C)C1NC(C)C1CC=CC1 |
| InChI | InChI=1S/C28H44FNO/c1-6-8-13-31-27-18-24(23-14-21(7-2)15-25(29)16-23)17-26(19(3)4)28(27)30-20(5)22-11-9-10-12-22/h9-10,14,17-20,22-23,25-26,28,30H,6-8,11-13,15-16H2,1-5H3 |
| InChIKey | XEXYWFLSTNCVQZ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|