C23H19F3N2O — CID 123564490
1-[4-(furan-2-yl)phenyl]-N-[2-[5-(trifluoromethyl)-1H-indol-3-yl]ethyl]ethanimine (PubChem CID 123564490) has the molecular formula C23H19F3N2O and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)phenyl]-N-[2-[5-(trifluoromethyl)-1H-indol-3-yl]ethyl]ethanimine.
| Compound Name | 1-[4-(furan-2-yl)phenyl]-N-[2-[5-(trifluoromethyl)-1H-indol-3-yl]ethyl]ethanimine |
|---|---|
| PubChem CID | 123564490 |
| Molecular Formula | C23H19F3N2O |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[4-(furan-2-yl)phenyl]-N-[2-[5-(trifluoromethyl)-1H-indol-3-yl]ethyl]ethanimine |
| SMILES | C/C(=N\CCc1c[nH]c2ccc(C(F)(F)F)cc12)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C23H19F3N2O/c1-15(16-4-6-17(7-5-16)22-3-2-12-29-22)27-11-10-18-14-28-21-9-8-19(13-20(18)21)23(24,25)26/h2-9,12-14,28H,10-11H2,1H3/b27-15+ |
| InChIKey | KEIZHLBWYQTGIF-JFLMPSFJSA-N |
| XLogP | 6.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|