C27H38N6O2S — CID 123564550
2-[12-[4-(dimethylamino)cyclohexyl]oxy-10-[(1,2-dimethyl-3,7-dihydro-2H-azepin-6-ylidene)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]acetamide (PubChem CID 123564550) has the molecular formula C27H38N6O2S and a molecular weight of 510.71 g/mol. Its IUPAC name is 2-[12-[4-(dimethylamino)cyclohexyl]oxy-10-[(1,2-dimethyl-3,7-dihydro-2H-azepin-6-ylidene)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]acetamide.
| Compound Name | 2-[12-[4-(dimethylamino)cyclohexyl]oxy-10-[(1,2-dimethyl-3,7-dihydro-2H-azepin-6-ylidene)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]acetamide |
|---|---|
| PubChem CID | 123564550 |
| Molecular Formula | C27H38N6O2S |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 2-[12-[4-(dimethylamino)cyclohexyl]oxy-10-[(1,2-dimethyl-3,7-dihydro-2H-azepin-6-ylidene)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl]acetamide |
| SMILES | CC1CC=CC(=Nc2nc(OC3CCC(N(C)C)CC3)c3c4c(sc3n2)CCC4CC(N)=O)CN1C |
| InChI | InChI=1S/C27H38N6O2S/c1-16-6-5-7-18(15-33(16)4)29-27-30-25(35-20-11-9-19(10-12-20)32(2)3)24-23-17(14-22(28)34)8-13-21(23)36-26(24)31-27/h5,7,16-17,19-20H,6,8-15H2,1-4H3,(H2,28,34) |
| InChIKey | QEDGOGYDYSKJLX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|