About 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine
6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine (PubChem CID 123565349) has the molecular formula C9H10BrN3
and a molecular weight of 240.10 g/mol. Its IUPAC name is 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine.
Molecular Properties
| Compound Name | 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine |
| PubChem CID | 123565349 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine |
| SMILES | CCc1cnc2c(N)cc(Br)cn12 |
| InChI | InChI=1S/C9H10BrN3/c1-2-7-4-12-9-8(11)3-6(10)5-13(7)9/h3-5H,2,11H2,1H3 |
| InChIKey | WUYHWDYAWYXCAP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine?
The IUPAC name of 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine (CID 123565349) is 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine.
What is the SMILES notation for 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine?
The canonical SMILES for 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine is CCc1cnc2c(N)cc(Br)cn12.
What is the InChIKey of 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine?
The InChIKey is WUYHWDYAWYXCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN3/c1-2-7-4-12-9-8(11)3-6(10)5-13(7)9/h3-5H,2,11H2,1H3.
What are the key properties of 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine?
6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine has a molecular weight of 240.10 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-ethylimidazo[1,2-a]pyridin-8-amine is sourced from PubChem (CID 123565349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).