C35H42O3 — CID 123565500
2-acetyl-7-[2-(cyclohexen-1-yl)prop-1-enyl]-3,4a,5a,10,12,12a-hexamethyl-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 123565500) has the molecular formula C35H42O3 and a molecular weight of 510.72 g/mol. Its IUPAC name is 2-acetyl-7-[2-(cyclohexen-1-yl)prop-1-enyl]-3,4a,5a,10,12,12a-hexamethyl-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-7-[2-(cyclohexen-1-yl)prop-1-enyl]-3,4a,5a,10,12,12a-hexamethyl-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 123565500 |
| Molecular Formula | C35H42O3 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 2-acetyl-7-[2-(cyclohexen-1-yl)prop-1-enyl]-3,4a,5a,10,12,12a-hexamethyl-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)Cc4c(C=C(C)C5=CCCCC5)ccc(C)c4C(=O)C3=C(C)C2(C)C1=O |
| InChI | InChI=1S/C35H42O3/c1-20-14-15-26(16-21(2)25-12-10-9-11-13-25)27-18-33(6)19-34(7)17-22(3)28(24(5)36)32(38)35(34,8)23(4)30(33)31(37)29(20)27/h12,14-16H,9-11,13,17-19H2,1-8H3 |
| InChIKey | BSWICTDUQJIBMN-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|