About (4-fluorophenyl)methyl N-methylprop-2-enimidate
(4-fluorophenyl)methyl N-methylprop-2-enimidate (PubChem CID 123565522) has the molecular formula C11H12FNO
and a molecular weight of 193.22 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N-methylprop-2-enimidate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl N-methylprop-2-enimidate |
| PubChem CID | 123565522 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (4-fluorophenyl)methyl N-methylprop-2-enimidate |
| SMILES | C=C/C(=N\C)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FNO/c1-3-11(13-2)14-8-9-4-6-10(12)7-5-9/h3-7H,1,8H2,2H3/b13-11+ |
| InChIKey | QVEGWWTWOUYFEY-ACCUITESSA-N |
| XLogP | 2.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)methyl N-methylprop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl N-methylprop-2-enimidate?
The IUPAC name of (4-fluorophenyl)methyl N-methylprop-2-enimidate (CID 123565522) is (4-fluorophenyl)methyl N-methylprop-2-enimidate.
What is the SMILES notation for (4-fluorophenyl)methyl N-methylprop-2-enimidate?
The canonical SMILES for (4-fluorophenyl)methyl N-methylprop-2-enimidate is C=C/C(=N\C)OCc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl)methyl N-methylprop-2-enimidate?
The InChIKey is QVEGWWTWOUYFEY-ACCUITESSA-N. The full InChI is InChI=1S/C11H12FNO/c1-3-11(13-2)14-8-9-4-6-10(12)7-5-9/h3-7H,1,8H2,2H3/b13-11+.
What are the key properties of (4-fluorophenyl)methyl N-methylprop-2-enimidate?
(4-fluorophenyl)methyl N-methylprop-2-enimidate has a molecular weight of 193.22 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl N-methylprop-2-enimidate is sourced from PubChem (CID 123565522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).