C19H22FN5O3S — CID 123565799
2-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-(1-methylcyclopropyl)oxyaniline (PubChem CID 123565799) has the molecular formula C19H22FN5O3S and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-(1-methylcyclopropyl)oxyaniline.
| Compound Name | 2-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-(1-methylcyclopropyl)oxyaniline |
|---|---|
| PubChem CID | 123565799 |
| Molecular Formula | C19H22FN5O3S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-(1-methylcyclopropyl)oxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCS(=O)(=O)CC2)ncn1)c1cc(OC2(C)CC2)c(F)cc1N |
| InChI | InChI=1S/C19H22FN5O3S/c1-19(2-3-19)28-16-8-12(14(21)9-13(16)20)18(22)15-10-17(24-11-23-15)25-4-6-29(26,27)7-5-25/h8-11,22H,2-7,21H2,1H3/b22-18- |
| InChIKey | CCWBGTIVIBWVRD-PYCFMQQDSA-N |
| XLogP | 1.78 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|