C34H33NO8 — CID 123565881
2-acetyl-5,10,12a-trihydroxy-9-[[5-(4-methoxyphenyl)-1H-pyrrol-2-yl]methyl]-3,6-dimethyl-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione (PubChem CID 123565881) has the molecular formula C34H33NO8 and a molecular weight of 583.64 g/mol. Its IUPAC name is 2-acetyl-5,10,12a-trihydroxy-9-[[5-(4-methoxyphenyl)-1H-pyrrol-2-yl]methyl]-3,6-dimethyl-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione.
| Compound Name | 2-acetyl-5,10,12a-trihydroxy-9-[[5-(4-methoxyphenyl)-1H-pyrrol-2-yl]methyl]-3,6-dimethyl-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 123565881 |
| Molecular Formula | C34H33NO8 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 2-acetyl-5,10,12a-trihydroxy-9-[[5-(4-methoxyphenyl)-1H-pyrrol-2-yl]methyl]-3,6-dimethyl-4,4a,5,5a,6,11a-hexahydrotetracene-1,11,12-trione |
| SMILES | COc1ccc(-c2ccc(Cc3ccc4c(c3O)C(=O)C3C(=O)C5(O)C(=O)C(C(C)=O)=C(C)CC5C(O)C3C4C)[nH]2)cc1 |
| InChI | InChI=1S/C34H33NO8/c1-15-13-23-30(38)26-16(2)22-11-7-19(14-20-8-12-24(35-20)18-5-9-21(43-4)10-6-18)29(37)27(22)31(39)28(26)33(41)34(23,42)32(40)25(15)17(3)36/h5-12,16,23,26,28,30,35,37-38,42H,13-14H2,1-4H3 |
| InChIKey | KNHPNAYNMFXWBR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 153.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|