C11H18N2O3S — CID 123566359
2,5-dimethyl-4-(piperidin-4-ylsulfonylmethyl)-1,3-oxazole (PubChem CID 123566359) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2,5-dimethyl-4-(piperidin-4-ylsulfonylmethyl)-1,3-oxazole.
| Compound Name | 2,5-dimethyl-4-(piperidin-4-ylsulfonylmethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 123566359 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2,5-dimethyl-4-(piperidin-4-ylsulfonylmethyl)-1,3-oxazole |
| SMILES | Cc1nc(CS(=O)(=O)C2CCNCC2)c(C)o1 |
| InChI | InChI=1S/C11H18N2O3S/c1-8-11(13-9(2)16-8)7-17(14,15)10-3-5-12-6-4-10/h10,12H,3-7H2,1-2H3 |
| InChIKey | PVSGGFOGKTYJOR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |