C20H21N5O3S — CID 123566375
[3-[[2-(3-ethynylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 123566375) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is [3-[[2-(3-ethynylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [3-[[2-(3-ethynylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 123566375 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [3-[[2-(3-ethynylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | C#Cc1cccc(-c2cc3nccc(NC4CCC(COS(N)(=O)=O)C4)n3n2)c1 |
| InChI | InChI=1S/C20H21N5O3S/c1-2-14-4-3-5-16(10-14)18-12-20-22-9-8-19(25(20)24-18)23-17-7-6-15(11-17)13-28-29(21,26)27/h1,3-5,8-10,12,15,17,23H,6-7,11,13H2,(H2,21,26,27) |
| InChIKey | URXABCYTMWSMAE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|