C10H13F3N6O2 — CID 123566565
1-[6-amino-5-diazenyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 123566565) has the molecular formula C10H13F3N6O2 and a molecular weight of 306.25 g/mol. Its IUPAC name is 1-[6-amino-5-diazenyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | 1-[6-amino-5-diazenyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 123566565 |
| Molecular Formula | C10H13F3N6O2 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[6-amino-5-diazenyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | [H]/N=N/c1c(N)nc(OCC(F)(F)F)nc1N1CCC(O)C1 |
| InChI | InChI=1S/C10H13F3N6O2/c11-10(12,13)4-21-9-16-7(14)6(18-15)8(17-9)19-2-1-5(20)3-19/h5,15,20H,1-4H2,(H2,14,16,17)/b18-15+ |
| InChIKey | JESQMOJAKOVQJM-OBGWFSINSA-N |
| XLogP | 1.23 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|