C23H22N8O2 — CID 123566702
1-[4-hydroxy-2-[10-[4-(triazol-2-ylmethyl)phenyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]ethanone (PubChem CID 123566702) has the molecular formula C23H22N8O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-[4-hydroxy-2-[10-[4-(triazol-2-ylmethyl)phenyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[4-hydroxy-2-[10-[4-(triazol-2-ylmethyl)phenyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 123566702 |
| Molecular Formula | C23H22N8O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-[4-hydroxy-2-[10-[4-(triazol-2-ylmethyl)phenyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(O)CC1c1nc(-c2ccc(Cn3nccn3)cc2)c2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C23H22N8O2/c1-14(32)29-13-17(33)10-19(29)23-28-21(20-11-25-22-18(31(20)23)6-7-24-22)16-4-2-15(3-5-16)12-30-26-8-9-27-30/h2-9,11,17,19,24,33H,10,12-13H2,1H3 |
| InChIKey | SKKLPEMSRSOGFJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |