C26H36F2N6O — CID 123567308
5-[5-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-1-butan-2-ylpyrazol-3-yl]-3-(difluoromethoxy)pyridin-2-amine (PubChem CID 123567308) has the molecular formula C26H36F2N6O and a molecular weight of 486.61 g/mol. Its IUPAC name is 5-[5-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-1-butan-2-ylpyrazol-3-yl]-3-(difluoromethoxy)pyridin-2-amine.
| Compound Name | 5-[5-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-1-butan-2-ylpyrazol-3-yl]-3-(difluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 123567308 |
| Molecular Formula | C26H36F2N6O |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 5-[5-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-1-butan-2-ylpyrazol-3-yl]-3-(difluoromethoxy)pyridin-2-amine |
| SMILES | CCC(C)n1nc(-c2cnc(N)c(OC(F)F)c2)cc1C1C2CC(N3CCN4CCCC4C3)CC21 |
| InChI | InChI=1S/C26H36F2N6O/c1-3-15(2)34-22(12-21(31-34)16-9-23(35-26(27)28)25(29)30-13-16)24-19-10-18(11-20(19)24)33-8-7-32-6-4-5-17(32)14-33/h9,12-13,15,17-20,24,26H,3-8,10-11,14H2,1-2H3,(H2,29,30) |
| InChIKey | GPMDUNKBVGIELT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |