C33H43ClF2N2O3 — CID 123567613
2-[[3-[2-(4-chlorocyclohexa-1,3-dien-1-yl)-2-oxoethyl]cyclohexyl]methyl]-N-[2-(1,1-difluoropropoxy)ethyl]-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123567613) has the molecular formula C33H43ClF2N2O3 and a molecular weight of 589.17 g/mol. Its IUPAC name is 2-[[3-[2-(4-chlorocyclohexa-1,3-dien-1-yl)-2-oxoethyl]cyclohexyl]methyl]-N-[2-(1,1-difluoropropoxy)ethyl]-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | 2-[[3-[2-(4-chlorocyclohexa-1,3-dien-1-yl)-2-oxoethyl]cyclohexyl]methyl]-N-[2-(1,1-difluoropropoxy)ethyl]-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123567613 |
| Molecular Formula | C33H43ClF2N2O3 |
| Molecular Weight | 589.17 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 2-[[3-[2-(4-chlorocyclohexa-1,3-dien-1-yl)-2-oxoethyl]cyclohexyl]methyl]-N-[2-(1,1-difluoropropoxy)ethyl]-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | CCC(F)(F)OCCNC(=O)c1cc2c(cc1C)=CCC(C)N(CC1CCCC(CC(=O)C3=CC=C(Cl)CC3)C1)C=2 |
| InChI | InChI=1S/C33H43ClF2N2O3/c1-4-33(35,36)41-15-14-37-32(40)30-19-28-21-38(23(3)8-9-27(28)16-22(30)2)20-25-7-5-6-24(17-25)18-31(39)26-10-12-29(34)13-11-26/h9-10,12,16,19,21,23-25H,4-8,11,13-15,17-18,20H2,1-3H3,(H,37,40) |
| InChIKey | HMUSFNSISPPVTE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.17 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|