C24H26N6O3 — CID 123567633
(Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyano-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 123567633) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is (Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyano-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyano-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 123567633 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyano-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | [C-]#[N+]/C(=C\c1c(-c2ccc(C)cc2)c2c(N)ncnc2n1CCCO)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H26N6O3/c1-16-4-6-17(7-5-16)20-19(14-18(26-2)24(32)29-9-12-33-13-10-29)30(8-3-11-31)23-21(20)22(25)27-15-28-23/h4-7,14-15,31H,3,8-13H2,1H3,(H2,25,27,28)/b18-14- |
| InChIKey | LDEFECNGHTWSIP-JXAWBTAJSA-N |
| XLogP | 2.49 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|