About 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde
3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde (PubChem CID 123567881) has the molecular formula C22H28O2Si
and a molecular weight of 352.55 g/mol. Its IUPAC name is 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde.
Molecular Properties
| Compound Name | 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde |
| PubChem CID | 123567881 |
| Molecular Formula | C22H28O2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde |
| SMILES | Cc1cc(O[Si](C)(C)C(C)(C)C)c2c(c1-c1cccc(C=O)c1)CC2 |
| InChI | InChI=1S/C22H28O2Si/c1-15-12-20(24-25(5,6)22(2,3)4)18-10-11-19(18)21(15)17-9-7-8-16(13-17)14-23/h7-9,12-14H,10-11H2,1-6H3 |
| InChIKey | BYLVAPRETZDFGA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde?
The IUPAC name of 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde (CID 123567881) is 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde.
What is the SMILES notation for 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde?
The canonical SMILES for 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde is Cc1cc(O[Si](C)(C)C(C)(C)C)c2c(c1-c1cccc(C=O)c1)CC2.
What is the InChIKey of 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde?
The InChIKey is BYLVAPRETZDFGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O2Si/c1-15-12-20(24-25(5,6)22(2,3)4)18-10-11-19(18)21(15)17-9-7-8-16(13-17)14-23/h7-9,12-14H,10-11H2,1-6H3.
What are the key properties of 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde?
3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde has a molecular weight of 352.55 g/mol, XLogP of 5.96, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-bicyclo[4.2.0]octa-1,3,5-trienyl]benzaldehyde is sourced from PubChem (CID 123567881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).