About 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one
8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 123568122) has the molecular formula C11H18O4Si
and a molecular weight of 242.35 g/mol. Its IUPAC name is 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
Molecular Properties
| Compound Name | 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
| PubChem CID | 123568122 |
| Molecular Formula | C11H18O4Si |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | O=C1OCC2C3OC(CC3OCCC[SiH3])C12 |
| InChI | InChI=1S/C11H18O4Si/c12-11-9-6(5-14-11)10-8(4-7(9)15-10)13-2-1-3-16/h6-10H,1-5H2,16H3 |
| InChIKey | DGUVLLMTSHTTFO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one?
The IUPAC name of 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (CID 123568122) is 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
What is the SMILES notation for 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one?
The canonical SMILES for 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one is O=C1OCC2C3OC(CC3OCCC[SiH3])C12.
What is the InChIKey of 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one?
The InChIKey is DGUVLLMTSHTTFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4Si/c12-11-9-6(5-14-11)10-8(4-7(9)15-10)13-2-1-3-16/h6-10H,1-5H2,16H3.
What are the key properties of 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one?
8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one has a molecular weight of 242.35 g/mol, XLogP of -0.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-silylpropoxy)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one is sourced from PubChem (CID 123568122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).