About phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one
phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one (PubChem CID 123568124) has the molecular formula C10H12Cl3N2O2P
and a molecular weight of 329.55 g/mol. Its IUPAC name is phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one.
Molecular Properties
| Compound Name | phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one |
| PubChem CID | 123568124 |
| Molecular Formula | C10H12Cl3N2O2P |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one |
| SMILES | CC(C)N1C(=O)Cc2ccncc21.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12N2O.Cl3OP/c1-7(2)12-9-6-11-4-3-8(9)5-10(12)13;1-5(2,3)4/h3-4,6-7H,5H2,1-2H3; |
| InChIKey | ZOLCWSIFDGRJKB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one?
The IUPAC name of phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one (CID 123568124) is phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one.
What is the SMILES notation for phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one?
The canonical SMILES for phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one is CC(C)N1C(=O)Cc2ccncc21.O=P(Cl)(Cl)Cl.
What is the InChIKey of phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one?
The InChIKey is ZOLCWSIFDGRJKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O.Cl3OP/c1-7(2)12-9-6-11-4-3-8(9)5-10(12)13;1-5(2,3)4/h3-4,6-7H,5H2,1-2H3;.
What are the key properties of phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one?
phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one has a molecular weight of 329.55 g/mol, XLogP of 4.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoryl trichloride;1-propan-2-yl-3H-pyrrolo[2,3-c]pyridin-2-one is sourced from PubChem (CID 123568124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).