C12H17BFN3O2 — CID 123568185
5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)pyridin-2-amine (PubChem CID 123568185) has the molecular formula C12H17BFN3O2 and a molecular weight of 265.10 g/mol. Its IUPAC name is 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)pyridin-2-amine.
| Compound Name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)pyridin-2-amine |
|---|---|
| PubChem CID | 123568185 |
| Molecular Formula | C12H17BFN3O2 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)pyridin-2-amine |
| SMILES | [H]/N=C(\B1OC(C)(C)C(C)(C)O1)c1cc(F)cnc1N |
| InChI | InChI=1S/C12H17BFN3O2/c1-11(2)12(3,4)19-13(18-11)9(15)8-5-7(14)6-17-10(8)16/h5-6,15H,1-4H3,(H2,16,17)/b15-9- |
| InChIKey | PTIINSDAFFVJGZ-DHDCSXOGSA-N |
| XLogP | 1.80 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|