C30H37FN4O3 — CID 123569195
2-(cyclopropylmethyl)-7-[7-[(Z)-1-(4-fluorophenyl)-1-imino-4-methylpent-2-en-3-yl]-4-methyl-4,5-dihydro-3H-azepine-3-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one (PubChem CID 123569195) has the molecular formula C30H37FN4O3 and a molecular weight of 520.65 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-7-[7-[(Z)-1-(4-fluorophenyl)-1-imino-4-methylpent-2-en-3-yl]-4-methyl-4,5-dihydro-3H-azepine-3-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one.
| Compound Name | 2-(cyclopropylmethyl)-7-[7-[(Z)-1-(4-fluorophenyl)-1-imino-4-methylpent-2-en-3-yl]-4-methyl-4,5-dihydro-3H-azepine-3-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 123569195 |
| Molecular Formula | C30H37FN4O3 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 2-(cyclopropylmethyl)-7-[7-[(Z)-1-(4-fluorophenyl)-1-imino-4-methylpent-2-en-3-yl]-4-methyl-4,5-dihydro-3H-azepine-3-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
| SMILES | [H]/N=C(/C=C(\C1=CCC(C)C(C(=O)N2CCN3C(=O)C(CC4CC4)OC3C2)C=N1)C(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H37FN4O3/c1-18(2)23(15-25(32)21-7-9-22(31)10-8-21)26-11-4-19(3)24(16-33-26)29(36)34-12-13-35-28(17-34)38-27(30(35)37)14-20-5-6-20/h7-11,15-16,18-20,24,27-28,32H,4-6,12-14,17H2,1-3H3/b23-15-,32-25- |
| InChIKey | FMQUCYLLQCDYPT-UTEBYQRHSA-N |
| XLogP | 4.58 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|