C12H9ClN2OS — CID 1235692
(5Z)-5-[(4-chlorophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-one (PubChem CID 1235692) has the molecular formula C12H9ClN2OS and a molecular weight of 264.74 g/mol. Its IUPAC name is (5Z)-5-[(4-chlorophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-one.
| Compound Name | (5Z)-5-[(4-chlorophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-one |
|---|---|
| PubChem CID | 1235692 |
| Molecular Formula | C12H9ClN2OS |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | (5Z)-5-[(4-chlorophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-one |
| SMILES | O=C1N=C2SCCN2/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9ClN2OS/c13-9-3-1-8(2-4-9)7-10-11(16)14-12-15(10)5-6-17-12/h1-4,7H,5-6H2/b10-7- |
| InChIKey | IWSSVBLSEOKVMQ-YFHOEESVSA-N |
| XLogP | 2.63 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|