About 4-(2,3-dimethylbut-3-enyl)morpholine
4-(2,3-dimethylbut-3-enyl)morpholine (PubChem CID 123569288) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-(2,3-dimethylbut-3-enyl)morpholine.
Molecular Properties
| Compound Name | 4-(2,3-dimethylbut-3-enyl)morpholine |
| PubChem CID | 123569288 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 4-(2,3-dimethylbut-3-enyl)morpholine |
| SMILES | C=C(C)C(C)CN1CCOCC1 |
| InChI | InChI=1S/C10H19NO/c1-9(2)10(3)8-11-4-6-12-7-5-11/h10H,1,4-8H2,2-3H3 |
| InChIKey | SLOOKHWHIJVURH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dimethylbut-3-enyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylbut-3-enyl)morpholine?
The IUPAC name of 4-(2,3-dimethylbut-3-enyl)morpholine (CID 123569288) is 4-(2,3-dimethylbut-3-enyl)morpholine.
What is the SMILES notation for 4-(2,3-dimethylbut-3-enyl)morpholine?
The canonical SMILES for 4-(2,3-dimethylbut-3-enyl)morpholine is C=C(C)C(C)CN1CCOCC1.
What is the InChIKey of 4-(2,3-dimethylbut-3-enyl)morpholine?
The InChIKey is SLOOKHWHIJVURH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-9(2)10(3)8-11-4-6-12-7-5-11/h10H,1,4-8H2,2-3H3.
What are the key properties of 4-(2,3-dimethylbut-3-enyl)morpholine?
4-(2,3-dimethylbut-3-enyl)morpholine has a molecular weight of 169.27 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylbut-3-enyl)morpholine is sourced from PubChem (CID 123569288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).