About 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine
4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine (PubChem CID 123569329) has the molecular formula C18H40N2O
and a molecular weight of 300.53 g/mol. Its IUPAC name is 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine.
Molecular Properties
| Compound Name | 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine |
| PubChem CID | 123569329 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine |
| SMILES | CC(C)NC(C)CC(C)(C)OCC(C)C(C)(C)NC(C)C |
| InChI | InChI=1S/C18H40N2O/c1-13(2)19-16(6)11-17(7,8)21-12-15(5)18(9,10)20-14(3)4/h13-16,19-20H,11-12H2,1-10H3 |
| InChIKey | CLGWMGBNGSCSNA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine?
The IUPAC name of 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine (CID 123569329) is 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine.
What is the SMILES notation for 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine?
The canonical SMILES for 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine is CC(C)NC(C)CC(C)(C)OCC(C)C(C)(C)NC(C)C.
What is the InChIKey of 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine?
The InChIKey is CLGWMGBNGSCSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40N2O/c1-13(2)19-16(6)11-17(7,8)21-12-15(5)18(9,10)20-14(3)4/h13-16,19-20H,11-12H2,1-10H3.
What are the key properties of 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine?
4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine has a molecular weight of 300.53 g/mol, XLogP of 3.97, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,3-dimethyl-3-(propan-2-ylamino)butoxy]-4-methyl-N-propan-2-ylpentan-2-amine is sourced from PubChem (CID 123569329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).