About 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol
1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol (PubChem CID 123570071) has the molecular formula C15H32NS+
and a molecular weight of 258.49 g/mol. Its IUPAC name is 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol.
Molecular Properties
| Compound Name | 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol |
| PubChem CID | 123570071 |
| Molecular Formula | C15H32NS+ |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol |
| SMILES | CCC(C)(C)C1C[N+](C)(C)CC1CC(C)(C)S |
| InChI | InChI=1S/C15H31NS/c1-8-14(2,3)13-11-16(6,7)10-12(13)9-15(4,5)17/h12-13H,8-11H2,1-7H3/p+1 |
| InChIKey | XRAQCDRLXQJLCI-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol?
The IUPAC name of 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol (CID 123570071) is 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol.
What is the SMILES notation for 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol?
The canonical SMILES for 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol is CCC(C)(C)C1C[N+](C)(C)CC1CC(C)(C)S.
What is the InChIKey of 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol?
The InChIKey is XRAQCDRLXQJLCI-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H31NS/c1-8-14(2,3)13-11-16(6,7)10-12(13)9-15(4,5)17/h12-13H,8-11H2,1-7H3/p+1.
What are the key properties of 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol?
1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol has a molecular weight of 258.49 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,1-dimethyl-4-(2-methylbutan-2-yl)pyrrolidin-1-ium-3-yl]-2-methylpropane-2-thiol is sourced from PubChem (CID 123570071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).