About 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine
11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine (PubChem CID 123570470) has the molecular formula C15H9FN2S
and a molecular weight of 268.32 g/mol. Its IUPAC name is 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine.
Molecular Properties
| Compound Name | 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine |
| PubChem CID | 123570470 |
| Molecular Formula | C15H9FN2S |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine |
| SMILES | Fc1cc2cccnc2c2c1-c1ccccc1SN2 |
| InChI | InChI=1S/C15H9FN2S/c16-11-8-9-4-3-7-17-14(9)15-13(11)10-5-1-2-6-12(10)19-18-15/h1-8,18H |
| InChIKey | HJJAMVAJGGLNDI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine?
The IUPAC name of 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine (CID 123570470) is 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine.
What is the SMILES notation for 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine?
The canonical SMILES for 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine is Fc1cc2cccnc2c2c1-c1ccccc1SN2.
What is the InChIKey of 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine?
The InChIKey is HJJAMVAJGGLNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9FN2S/c16-11-8-9-4-3-7-17-14(9)15-13(11)10-5-1-2-6-12(10)19-18-15/h1-8,18H.
What are the key properties of 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine?
11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine has a molecular weight of 268.32 g/mol, XLogP of 4.47, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-fluoro-5H-quinolino[8,7-c][1,2]benzothiazine is sourced from PubChem (CID 123570470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).