About 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium
2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium (PubChem CID 123570809) has the molecular formula C14H12Cl2N3+
and a molecular weight of 293.18 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium.
Molecular Properties
| Compound Name | 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium |
| PubChem CID | 123570809 |
| Molecular Formula | C14H12Cl2N3+ |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium |
| SMILES | Cc1c[n+](C)cc2cn(-c3c(Cl)cccc3Cl)nc12 |
| InChI | InChI=1S/C14H12Cl2N3/c1-9-6-18(2)7-10-8-19(17-13(9)10)14-11(15)4-3-5-12(14)16/h3-8H,1-2H3/q+1 |
| InChIKey | SVNDRQRCACXUEK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium?
The IUPAC name of 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium (CID 123570809) is 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium.
What is the SMILES notation for 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium?
The canonical SMILES for 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium is Cc1c[n+](C)cc2cn(-c3c(Cl)cccc3Cl)nc12.
What is the InChIKey of 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium?
The InChIKey is SVNDRQRCACXUEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N3/c1-9-6-18(2)7-10-8-19(17-13(9)10)14-11(15)4-3-5-12(14)16/h3-8H,1-2H3/q+1.
What are the key properties of 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium?
2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium has a molecular weight of 293.18 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)-5,7-dimethylpyrazolo[4,3-c]pyridin-5-ium is sourced from PubChem (CID 123570809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).