C24H20F4N4O3S — CID 123571011
5-[[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-hydroxypiperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 123571011) has the molecular formula C24H20F4N4O3S and a molecular weight of 520.51 g/mol. Its IUPAC name is 5-[[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-hydroxypiperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-hydroxypiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123571011 |
| Molecular Formula | C24H20F4N4O3S |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 5-[[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-hydroxypiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc3c(cnn3Cc3ccc(F)cc3C(F)(F)F)c2)C(=O)N1[C@H]1CCNC[C@@H]1O |
| InChI | InChI=1S/C24H20F4N4O3S/c25-16-3-2-14(17(9-16)24(26,27)28)12-31-18-4-1-13(7-15(18)10-30-31)8-21-22(34)32(23(35)36-21)19-5-6-29-11-20(19)33/h1-4,7-10,19-20,29,33H,5-6,11-12H2/t19-,20-/m0/s1 |
| InChIKey | HQLHZAOKIQTSBI-PMACEKPBSA-N |
| XLogP | 4.00 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|