About ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate
ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate (PubChem CID 123571132) has the molecular formula C17H32O3Si
and a molecular weight of 312.53 g/mol. Its IUPAC name is ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate.
Molecular Properties
| Compound Name | ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate |
| PubChem CID | 123571132 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate |
| SMILES | CCOC(=O)C(C)=CC=CC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-9-19-16(18)14(2)12-10-11-13-15(3)20-21(7,8)17(4,5)6/h10-12,15H,9,13H2,1-8H3/t15-/m0/s1 |
| InChIKey | KSEZTRRNPBUHDX-HNNXBMFYSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate?
The IUPAC name of ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate (CID 123571132) is ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate.
What is the SMILES notation for ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate?
The canonical SMILES for ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate is CCOC(=O)C(C)=CC=CC[C@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate?
The InChIKey is KSEZTRRNPBUHDX-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H32O3Si/c1-9-19-16(18)14(2)12-10-11-13-15(3)20-21(7,8)17(4,5)6/h10-12,15H,9,13H2,1-8H3/t15-/m0/s1.
What are the key properties of ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate?
ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate has a molecular weight of 312.53 g/mol, XLogP of 4.85, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,4-dienoate is sourced from PubChem (CID 123571132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).