C25H47ClN6O2 — CID 123571207
3,3-diamino-2-(6-chloro-1-ethyl-4,8-dimethyl-4-azabicyclo[6.1.0]nonan-3-yl)-N-[4-(1-methylpyrrolidin-3-yl)oxypiperidin-3-yl]propanamide (PubChem CID 123571207) has the molecular formula C25H47ClN6O2 and a molecular weight of 499.14 g/mol. Its IUPAC name is 3,3-diamino-2-(6-chloro-1-ethyl-4,8-dimethyl-4-azabicyclo[6.1.0]nonan-3-yl)-N-[4-(1-methylpyrrolidin-3-yl)oxypiperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(6-chloro-1-ethyl-4,8-dimethyl-4-azabicyclo[6.1.0]nonan-3-yl)-N-[4-(1-methylpyrrolidin-3-yl)oxypiperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123571207 |
| Molecular Formula | C25H47ClN6O2 |
| Molecular Weight | 499.14 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | 3,3-diamino-2-(6-chloro-1-ethyl-4,8-dimethyl-4-azabicyclo[6.1.0]nonan-3-yl)-N-[4-(1-methylpyrrolidin-3-yl)oxypiperidin-3-yl]propanamide |
| SMILES | CCC12CC(C(C(=O)NC3CNCCC3OC3CCN(C)C3)C(N)N)N(C)CC(Cl)CC1(C)C2 |
| InChI | InChI=1S/C25H47ClN6O2/c1-5-25-11-19(32(4)13-16(26)10-24(25,2)15-25)21(22(27)28)23(33)30-18-12-29-8-6-20(18)34-17-7-9-31(3)14-17/h16-22,29H,5-15,27-28H2,1-4H3,(H,30,33) |
| InChIKey | UHAZBEXZLPFAFT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.14 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|