C17H21N7 — CID 123571494
N-[(4-aminoanilino)-(methylideneamino)methylidene]-N'-(5-cyclopropyl-1H-pyrazol-3-yl)propanimidamide (PubChem CID 123571494) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(4-aminoanilino)-(methylideneamino)methylidene]-N'-(5-cyclopropyl-1H-pyrazol-3-yl)propanimidamide.
| Compound Name | N-[(4-aminoanilino)-(methylideneamino)methylidene]-N'-(5-cyclopropyl-1H-pyrazol-3-yl)propanimidamide |
|---|---|
| PubChem CID | 123571494 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[(4-aminoanilino)-(methylideneamino)methylidene]-N'-(5-cyclopropyl-1H-pyrazol-3-yl)propanimidamide |
| SMILES | C=N/C(=N/C(CC)=N/c1cc(C2CC2)[nH]n1)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C17H21N7/c1-3-15(21-16-10-14(23-24-16)11-4-5-11)22-17(19-2)20-13-8-6-12(18)7-9-13/h6-11H,2-5,18H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | ZHSYPPHFVXNZKN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|