About 5-(isothiocyanatomethyl)-2,3-dimethylheptane
5-(isothiocyanatomethyl)-2,3-dimethylheptane (PubChem CID 123571717) has the molecular formula C11H21NS
and a molecular weight of 199.36 g/mol. Its IUPAC name is 5-(isothiocyanatomethyl)-2,3-dimethylheptane.
Molecular Properties
| Compound Name | 5-(isothiocyanatomethyl)-2,3-dimethylheptane |
| PubChem CID | 123571717 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 5-(isothiocyanatomethyl)-2,3-dimethylheptane |
| SMILES | CCC(CN=C=S)CC(C)C(C)C |
| InChI | InChI=1S/C11H21NS/c1-5-11(7-12-8-13)6-10(4)9(2)3/h9-11H,5-7H2,1-4H3 |
| InChIKey | WUBQFPVGQYDABG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(isothiocyanatomethyl)-2,3-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(isothiocyanatomethyl)-2,3-dimethylheptane?
The IUPAC name of 5-(isothiocyanatomethyl)-2,3-dimethylheptane (CID 123571717) is 5-(isothiocyanatomethyl)-2,3-dimethylheptane.
What is the SMILES notation for 5-(isothiocyanatomethyl)-2,3-dimethylheptane?
The canonical SMILES for 5-(isothiocyanatomethyl)-2,3-dimethylheptane is CCC(CN=C=S)CC(C)C(C)C.
What is the InChIKey of 5-(isothiocyanatomethyl)-2,3-dimethylheptane?
The InChIKey is WUBQFPVGQYDABG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NS/c1-5-11(7-12-8-13)6-10(4)9(2)3/h9-11H,5-7H2,1-4H3.
What are the key properties of 5-(isothiocyanatomethyl)-2,3-dimethylheptane?
5-(isothiocyanatomethyl)-2,3-dimethylheptane has a molecular weight of 199.36 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(isothiocyanatomethyl)-2,3-dimethylheptane is sourced from PubChem (CID 123571717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).