C23H23N7O3 — CID 123571877
1-N-(4-morpholin-4-ylphenyl)-3-N-(5-nitro-2-pyridinyl)-5,8-dihydro-2,7-naphthyridine-1,3-diamine (PubChem CID 123571877) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-N-(4-morpholin-4-ylphenyl)-3-N-(5-nitro-2-pyridinyl)-5,8-dihydro-2,7-naphthyridine-1,3-diamine.
| Compound Name | 1-N-(4-morpholin-4-ylphenyl)-3-N-(5-nitro-2-pyridinyl)-5,8-dihydro-2,7-naphthyridine-1,3-diamine |
|---|---|
| PubChem CID | 123571877 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-N-(4-morpholin-4-ylphenyl)-3-N-(5-nitro-2-pyridinyl)-5,8-dihydro-2,7-naphthyridine-1,3-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2cc3c(c(Nc4ccc(N5CCOCC5)cc4)n2)CN=CC3)nc1 |
| InChI | InChI=1S/C23H23N7O3/c31-30(32)19-5-6-21(25-14-19)27-22-13-16-7-8-24-15-20(16)23(28-22)26-17-1-3-18(4-2-17)29-9-11-33-12-10-29/h1-6,8,13-14H,7,9-12,15H2,(H2,25,26,27,28) |
| InChIKey | VGVJYBVCZBKZHG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|