C29H31F3N6O3 — CID 123571989
6-[3-cyclopropyl-4-[1-(5-oxopyrrolidin-3-yl)ethoxy]imidazo[4,5-c]pyridin-6-yl]-1'-(2,2,2-trifluoroethyl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 123571989) has the molecular formula C29H31F3N6O3 and a molecular weight of 568.60 g/mol. Its IUPAC name is 6-[3-cyclopropyl-4-[1-(5-oxopyrrolidin-3-yl)ethoxy]imidazo[4,5-c]pyridin-6-yl]-1'-(2,2,2-trifluoroethyl)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 6-[3-cyclopropyl-4-[1-(5-oxopyrrolidin-3-yl)ethoxy]imidazo[4,5-c]pyridin-6-yl]-1'-(2,2,2-trifluoroethyl)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 123571989 |
| Molecular Formula | C29H31F3N6O3 |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 6-[3-cyclopropyl-4-[1-(5-oxopyrrolidin-3-yl)ethoxy]imidazo[4,5-c]pyridin-6-yl]-1'-(2,2,2-trifluoroethyl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | CC(Oc1nc(-c2ccc3c(c2)NC(=O)C32CCN(CC(F)(F)F)CC2)cc2ncn(C3CC3)c12)C1CNC(=O)C1 |
| InChI | InChI=1S/C29H31F3N6O3/c1-16(18-11-24(39)33-13-18)41-26-25-23(34-15-38(25)19-3-4-19)12-21(35-26)17-2-5-20-22(10-17)36-27(40)28(20)6-8-37(9-7-28)14-29(30,31)32/h2,5,10,12,15-16,18-19H,3-4,6-9,11,13-14H2,1H3,(H,33,39)(H,36,40) |
| InChIKey | JTGFYEGDEBIRFP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |