C8H6F3NO2S — CID 123573167
1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butane-1,3-dione (PubChem CID 123573167) has the molecular formula C8H6F3NO2S and a molecular weight of 237.20 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butane-1,3-dione.
| Compound Name | 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 123573167 |
| Molecular Formula | C8H6F3NO2S |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C8H6F3NO2S/c1-4(13)2-5(14)7-12-6(3-15-7)8(9,10)11/h3H,2H2,1H3 |
| InChIKey | VZARBEPZAOTWOH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|