C28H52ClN7O — CID 123573345
3,3-diamino-2-(10-chloro-3-methyl-8-azaspiro[4.8]tridecan-7-yl)-N-[4-(1,4-diazabicyclo[3.2.2]nonan-4-yl)piperidin-3-yl]propanamide (PubChem CID 123573345) has the molecular formula C28H52ClN7O and a molecular weight of 538.23 g/mol. Its IUPAC name is 3,3-diamino-2-(10-chloro-3-methyl-8-azaspiro[4.8]tridecan-7-yl)-N-[4-(1,4-diazabicyclo[3.2.2]nonan-4-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(10-chloro-3-methyl-8-azaspiro[4.8]tridecan-7-yl)-N-[4-(1,4-diazabicyclo[3.2.2]nonan-4-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123573345 |
| Molecular Formula | C28H52ClN7O |
| Molecular Weight | 538.23 g/mol |
| Exact Mass | 537.39 |
| IUPAC Name | 3,3-diamino-2-(10-chloro-3-methyl-8-azaspiro[4.8]tridecan-7-yl)-N-[4-(1,4-diazabicyclo[3.2.2]nonan-4-yl)piperidin-3-yl]propanamide |
| SMILES | CC1CCC2(CCCC(Cl)CNC(C(C(=O)NC3CNCCC3N3CCN4CCC3CC4)C(N)N)C2)C1 |
| InChI | InChI=1S/C28H52ClN7O/c1-19-4-9-28(15-19)8-2-3-20(29)17-33-22(16-28)25(26(30)31)27(37)34-23-18-32-10-5-24(23)36-14-13-35-11-6-21(36)7-12-35/h19-26,32-33H,2-18,30-31H2,1H3,(H,34,37) |
| InChIKey | QSQAIYZNDCSVOI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|