About 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole
4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole (PubChem CID 123574213) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole.
Molecular Properties
| Compound Name | 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole |
| PubChem CID | 123574213 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole |
| SMILES | CC1C=CSc2[nH]ncc21 |
| InChI | InChI=1S/C7H8N2S/c1-5-2-3-10-7-6(5)4-8-9-7/h2-5H,1H3,(H,8,9) |
| InChIKey | WOTSNSJZEDGWDC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole?
The IUPAC name of 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole (CID 123574213) is 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole.
What is the SMILES notation for 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole?
The canonical SMILES for 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole is CC1C=CSc2[nH]ncc21.
What is the InChIKey of 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole?
The InChIKey is WOTSNSJZEDGWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S/c1-5-2-3-10-7-6(5)4-8-9-7/h2-5H,1H3,(H,8,9).
What are the key properties of 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole?
4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole has a molecular weight of 152.22 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,4-dihydrothiopyrano[3,2-d]pyrazole is sourced from PubChem (CID 123574213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).