C26H35N9O2S — CID 123574248
N-[(2S)-1-[5-[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 123574248) has the molecular formula C26H35N9O2S and a molecular weight of 537.69 g/mol. Its IUPAC name is N-[(2S)-1-[5-[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | N-[(2S)-1-[5-[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 123574248 |
| Molecular Formula | C26H35N9O2S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | N-[(2S)-1-[5-[2-[(5-cyano-1,3-thiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | CCCNc1nc(Nc2ncc(C#N)s2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)C=CCN(C)C |
| InChI | InChI=1S/C26H35N9O2S/c1-6-13-28-23-20(17-30-25(32-23)33-26-31-18-21(16-27)38-26)11-8-7-9-14-29-24(37)19(2)35(5)22(36)12-10-15-34(3)4/h10,12,17-19H,6-7,9,13-15H2,1-5H3,(H,29,37)(H2,28,30,31,32,33)/t19-/m0/s1 |
| InChIKey | CWLLPSIDMQZWIR-IBGZPJMESA-N |
| XLogP | 2.58 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|