About (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform
(5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform (PubChem CID 123574370) has the molecular formula C17H23BrI3NOSi
and a molecular weight of 746.08 g/mol. Its IUPAC name is (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform.
Molecular Properties
| Compound Name | (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform |
| PubChem CID | 123574370 |
| Molecular Formula | C17H23BrI3NOSi |
| Molecular Weight | 746.08 g/mol |
| Exact Mass | 744.79 |
| IUPAC Name | (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nccc2c(Br)cccc12.IC(I)I |
| InChI | InChI=1S/C16H22BrNOSi.CHI3/c1-16(2,3)20(4,5)19-11-15-13-7-6-8-14(17)12(13)9-10-18-15;2-1(3)4/h6-10H,11H2,1-5H3;1H |
| InChIKey | HSOVYQGEZVNMTB-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 746.08 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform?
The IUPAC name of (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform (CID 123574370) is (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform.
What is the SMILES notation for (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform?
The canonical SMILES for (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform is CC(C)(C)[Si](C)(C)OCc1nccc2c(Br)cccc12.IC(I)I.
What is the InChIKey of (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform?
The InChIKey is HSOVYQGEZVNMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNOSi.CHI3/c1-16(2,3)20(4,5)19-11-15-13-7-6-8-14(17)12(13)9-10-18-15;2-1(3)4/h6-10H,11H2,1-5H3;1H.
What are the key properties of (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform?
(5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform has a molecular weight of 746.08 g/mol, XLogP of 8.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromoisoquinolin-1-yl)methoxy-tert-butyl-dimethylsilane;iodoform is sourced from PubChem (CID 123574370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).