C21H25ClFN3O2 — CID 123574599
8-[(3-chloro-4-fluorophenyl)methyl]-2-(2-methoxyethyl)-3-methyl-3,5,9,10-tetrahydro-1H-imidazo[5,1-a][2,6]naphthyridin-6-one (PubChem CID 123574599) has the molecular formula C21H25ClFN3O2 and a molecular weight of 405.90 g/mol. Its IUPAC name is 8-[(3-chloro-4-fluorophenyl)methyl]-2-(2-methoxyethyl)-3-methyl-3,5,9,10-tetrahydro-1H-imidazo[5,1-a][2,6]naphthyridin-6-one.
| Compound Name | 8-[(3-chloro-4-fluorophenyl)methyl]-2-(2-methoxyethyl)-3-methyl-3,5,9,10-tetrahydro-1H-imidazo[5,1-a][2,6]naphthyridin-6-one |
|---|---|
| PubChem CID | 123574599 |
| Molecular Formula | C21H25ClFN3O2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 8-[(3-chloro-4-fluorophenyl)methyl]-2-(2-methoxyethyl)-3-methyl-3,5,9,10-tetrahydro-1H-imidazo[5,1-a][2,6]naphthyridin-6-one |
| SMILES | COCCN1CC2=C3CCN(Cc4ccc(F)c(Cl)c4)C=C3C(=O)CN2C1C |
| InChI | InChI=1S/C21H25ClFN3O2/c1-14-25(7-8-28-2)12-20-16-5-6-24(11-17(16)21(27)13-26(14)20)10-15-3-4-19(23)18(22)9-15/h3-4,9,11,14H,5-8,10,12-13H2,1-2H3 |
| InChIKey | VIGAXYBXFFQITC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |