C24H20Cl2N4O4S2 — CID 123574630
6-[(2,6-dichlorophenyl)methylsulfonyl]-2-[(2-morpholin-4-ylpyrimidin-4-yl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 123574630) has the molecular formula C24H20Cl2N4O4S2 and a molecular weight of 563.49 g/mol. Its IUPAC name is 6-[(2,6-dichlorophenyl)methylsulfonyl]-2-[(2-morpholin-4-ylpyrimidin-4-yl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[(2,6-dichlorophenyl)methylsulfonyl]-2-[(2-morpholin-4-ylpyrimidin-4-yl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 123574630 |
| Molecular Formula | C24H20Cl2N4O4S2 |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | 6-[(2,6-dichlorophenyl)methylsulfonyl]-2-[(2-morpholin-4-ylpyrimidin-4-yl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2cc(S(=O)(=O)Cc3c(Cl)cccc3Cl)ccc2SC1=Cc1ccnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H20Cl2N4O4S2/c25-18-2-1-3-19(26)17(18)14-36(32,33)16-4-5-21-20(13-16)29-23(31)22(35-21)12-15-6-7-27-24(28-15)30-8-10-34-11-9-30/h1-7,12-13H,8-11,14H2,(H,29,31) |
| InChIKey | CCXBPGYSYVDWTO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|